Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
(+/-)-Atenolol
CAS: 29122-68-7 Molecular Formula: C14H22N2O3 Molecular Weight (g/mol): 266.341 MDL Number: MFCD00057645 InChI Key: METKIMKYRPQLGS-UHFFFAOYSA-N Synonym: atenolol,tenormin,tenormine,normiten,blokium,prenormine,tenoblock,atehexal,betablok,cuxanorm PubChem CID: 2249 ChEBI: CHEBI:2904 IUPAC Name: 2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetamide SMILES: CC(C)NCC(COC1=CC=C(C=C1)CC(=O)N)O
| PubChem CID | 2249 |
|---|---|
| CAS | 29122-68-7 |
| Molecular Weight (g/mol) | 266.341 |
| ChEBI | CHEBI:2904 |
| MDL Number | MFCD00057645 |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)CC(=O)N)O |
| Synonym | atenolol,tenormin,tenormine,normiten,blokium,prenormine,tenoblock,atehexal,betablok,cuxanorm |
| IUPAC Name | 2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetamide |
| InChI Key | METKIMKYRPQLGS-UHFFFAOYSA-N |
| Molecular Formula | C14H22N2O3 |
4-Chloro-7-Nitrobenz-2-Oxa-1,3-Diazole, ∽98 to 99%, MP Biomedicals™
CAS: 10199-89-0 Molecular Formula: C6H2ClN3O3 Molecular Weight (g/mol): 199.55 InChI Key: IGHBXJSNZCFXNK-UHFFFAOYSA-N Synonym: 4-chloro-7-nitrobenzofurazan,nbd chloride,4-chloro-7-nitrobenzo-2-oxa-1,3-diazole,nbd-cl,7-chloro-4-nitrobenzofurazan,2,1,3-benzoxadiazole, 4-chloro-7-nitro,nbd-chloride,nbd-c 1,1-chloro-4-nitrobenzoxadiazole,4-nitro-7-chlorobenzofurazan PubChem CID: 25043 ChEBI: CHEBI:78878 IUPAC Name: 4-chloro-7-nitro-2,1,3-benzoxadiazole SMILES: C1=C(C2=NON=C2C(=C1)Cl)[N+](=O)[O-]
| PubChem CID | 25043 |
|---|---|
| CAS | 10199-89-0 |
| Molecular Weight (g/mol) | 199.55 |
| ChEBI | CHEBI:78878 |
| SMILES | C1=C(C2=NON=C2C(=C1)Cl)[N+](=O)[O-] |
| Synonym | 4-chloro-7-nitrobenzofurazan,nbd chloride,4-chloro-7-nitrobenzo-2-oxa-1,3-diazole,nbd-cl,7-chloro-4-nitrobenzofurazan,2,1,3-benzoxadiazole, 4-chloro-7-nitro,nbd-chloride,nbd-c 1,1-chloro-4-nitrobenzoxadiazole,4-nitro-7-chlorobenzofurazan |
| IUPAC Name | 4-chloro-7-nitro-2,1,3-benzoxadiazole |
| InChI Key | IGHBXJSNZCFXNK-UHFFFAOYSA-N |
| Molecular Formula | C6H2ClN3O3 |
Ethyl oleate, 98%, mixture of homologeous fatty acid esters
CAS: 111-62-6 Molecular Formula: C20H38O2 Molecular Weight (g/mol): 310.51 InChI Key: LVGKNOAMLMIIKO-QXMHVHEDSA-N Synonym: ethyl oleate,ethyl cis-9-octadecenoate,oleic acid, ethyl ester,oleic acid ethyl ester,9-octadecenoic acid z-, ethyl ester,ethyl oleate nf,ethyl z-octadec-9-enoate,ethyl oleate natural,fema no. 2450 PubChem CID: 5363269 ChEBI: CHEBI:84940 IUPAC Name: ethyl (Z)-octadec-9-enoate SMILES: CCCCCCCCC=CCCCCCCCC(=O)OCC
| PubChem CID | 5363269 |
|---|---|
| CAS | 111-62-6 |
| Molecular Weight (g/mol) | 310.51 |
| ChEBI | CHEBI:84940 |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC |
| Synonym | ethyl oleate,ethyl cis-9-octadecenoate,oleic acid, ethyl ester,oleic acid ethyl ester,9-octadecenoic acid z-, ethyl ester,ethyl oleate nf,ethyl z-octadec-9-enoate,ethyl oleate natural,fema no. 2450 |
| IUPAC Name | ethyl (Z)-octadec-9-enoate |
| InChI Key | LVGKNOAMLMIIKO-QXMHVHEDSA-N |
| Molecular Formula | C20H38O2 |
4-tert-Butylcatechol, 99%
CAS: 98-29-3 Molecular Formula: C10H14O2 Molecular Weight (g/mol): 166.22 MDL Number: MFCD00002201 InChI Key: XESZUVZBAMCAEJ-UHFFFAOYSA-N Synonym: 4-tert-butylcatechol,p-tert-butylcatechol,4-tert-butylpyrocatechol,p-tert-butyl catechol,4-tert-butyl benzene-1,2-diol,4-t-butylpyrocatechol,p-tert-butylpyrocatechol,4-t-butylcatechol,1,2-benzenediol, 4-1,1-dimethylethyl,4-tert-butylcatechin PubChem CID: 7381 IUPAC Name: 4-tert-butylbenzene-1,2-diol SMILES: CC(C)(C)C1=CC=C(O)C(O)=C1
| PubChem CID | 7381 |
|---|---|
| CAS | 98-29-3 |
| Molecular Weight (g/mol) | 166.22 |
| MDL Number | MFCD00002201 |
| SMILES | CC(C)(C)C1=CC=C(O)C(O)=C1 |
| Synonym | 4-tert-butylcatechol,p-tert-butylcatechol,4-tert-butylpyrocatechol,p-tert-butyl catechol,4-tert-butyl benzene-1,2-diol,4-t-butylpyrocatechol,p-tert-butylpyrocatechol,4-t-butylcatechol,1,2-benzenediol, 4-1,1-dimethylethyl,4-tert-butylcatechin |
| IUPAC Name | 4-tert-butylbenzene-1,2-diol |
| InChI Key | XESZUVZBAMCAEJ-UHFFFAOYSA-N |
| Molecular Formula | C10H14O2 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, disodium salt dihydrate, 99+%, for molecular biology, DNAse, RNAse and Protease free
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
2',4',6'-Trihydroxyacetophenone, 98%
CAS: 480-66-0 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00002287 InChI Key: XLEYFDVVXLMULC-UHFFFAOYSA-N Synonym: 1-2,4,6-trihydroxyphenyl ethanone,2',4',6'-trihydroxyacetophenone,phloroacetophenone,phloracetophenone,acetophloroglucine,2,4,6-trihydroxyacetophenone,acetylphloroglucinol,ethanone, 1-2,4,6-trihydroxyphenyl,2-acetylphloroglucinol,1-2,4,6-trihydroxyphenyl-ethanone PubChem CID: 68073 ChEBI: CHEBI:64344 IUPAC Name: 1-(2,4,6-trihydroxyphenyl)ethanone SMILES: CC(=O)C1=C(O)C=C(O)C=C1O
| PubChem CID | 68073 |
|---|---|
| CAS | 480-66-0 |
| Molecular Weight (g/mol) | 168.15 |
| ChEBI | CHEBI:64344 |
| MDL Number | MFCD00002287 |
| SMILES | CC(=O)C1=C(O)C=C(O)C=C1O |
| Synonym | 1-2,4,6-trihydroxyphenyl ethanone,2',4',6'-trihydroxyacetophenone,phloroacetophenone,phloracetophenone,acetophloroglucine,2,4,6-trihydroxyacetophenone,acetylphloroglucinol,ethanone, 1-2,4,6-trihydroxyphenyl,2-acetylphloroglucinol,1-2,4,6-trihydroxyphenyl-ethanone |
| IUPAC Name | 1-(2,4,6-trihydroxyphenyl)ethanone |
| InChI Key | XLEYFDVVXLMULC-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
Ethyl Benzoate, 99+%
CAS: 93-89-0 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00009109 InChI Key: MTZQAGJQAFMTAQ-UHFFFAOYSA-N Synonym: benzoic acid, ethyl ester,benzoic ether,ethyl benzenecarboxylate,ethylbenzoate,benzoyl ethyl ether,benzoic acid ethyl ester,ethylester kyseliny benzoove,natural,unii-j115brj15h,fema no. 2422 PubChem CID: 7165 IUPAC Name: ethyl benzoate SMILES: CCOC(=O)C1=CC=CC=C1
| PubChem CID | 7165 |
|---|---|
| CAS | 93-89-0 |
| Molecular Weight (g/mol) | 150.18 |
| MDL Number | MFCD00009109 |
| SMILES | CCOC(=O)C1=CC=CC=C1 |
| Synonym | benzoic acid, ethyl ester,benzoic ether,ethyl benzenecarboxylate,ethylbenzoate,benzoyl ethyl ether,benzoic acid ethyl ester,ethylester kyseliny benzoove,natural,unii-j115brj15h,fema no. 2422 |
| IUPAC Name | ethyl benzoate |
| InChI Key | MTZQAGJQAFMTAQ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
Decanophenone 98.0+%, TCI America™
CAS: 6048-82-4 Molecular Formula: C16H24O Molecular Weight (g/mol): 232.37 MDL Number: MFCD00009582 InChI Key: QQXJNLYVPPBERR-UHFFFAOYSA-N Synonym: decanophenone,1-decanone, 1-phenyl,n-decanophenone,capriphenone,ketone, nonyl phenyl,ketone, nonenyl phenyl,nonyl phenyl ketone,1-phenyl-1-decanone,acmc-209mkb PubChem CID: 80148 IUPAC Name: 1-phenyldecan-1-one SMILES: CCCCCCCCCC(=O)C1=CC=CC=C1
| PubChem CID | 80148 |
|---|---|
| CAS | 6048-82-4 |
| Molecular Weight (g/mol) | 232.37 |
| MDL Number | MFCD00009582 |
| SMILES | CCCCCCCCCC(=O)C1=CC=CC=C1 |
| Synonym | decanophenone,1-decanone, 1-phenyl,n-decanophenone,capriphenone,ketone, nonyl phenyl,ketone, nonenyl phenyl,nonyl phenyl ketone,1-phenyl-1-decanone,acmc-209mkb |
| IUPAC Name | 1-phenyldecan-1-one |
| InChI Key | QQXJNLYVPPBERR-UHFFFAOYSA-N |
| Molecular Formula | C16H24O |
2,2,2-Trifluoroethylamine, 99.5%
CAS: 753-90-2 Molecular Formula: C2H4F3N Molecular Weight (g/mol): 99.06 MDL Number: MFCD00008132 InChI Key: KIPSRYDSZQRPEA-UHFFFAOYSA-N Synonym: 2,2,2-trifluoroethylamine,trifluoroethylamine,ethanamine, 2,2,2-trifluoro,2,2,2-trifluoroethan-1-amine,2-amino-1,1,1-trifluoroethane,ethylamine, 2,2,2-trifluoro,2,2,2-trifluoro-ethylamine,2,2,2-trifluorethanamin,trifluoro ethylamine,trifluoroethyl amine PubChem CID: 9773 IUPAC Name: 2,2,2-trifluoroethanamine SMILES: C(C(F)(F)F)N
| PubChem CID | 9773 |
|---|---|
| CAS | 753-90-2 |
| Molecular Weight (g/mol) | 99.06 |
| MDL Number | MFCD00008132 |
| SMILES | C(C(F)(F)F)N |
| Synonym | 2,2,2-trifluoroethylamine,trifluoroethylamine,ethanamine, 2,2,2-trifluoro,2,2,2-trifluoroethan-1-amine,2-amino-1,1,1-trifluoroethane,ethylamine, 2,2,2-trifluoro,2,2,2-trifluoro-ethylamine,2,2,2-trifluorethanamin,trifluoro ethylamine,trifluoroethyl amine |
| IUPAC Name | 2,2,2-trifluoroethanamine |
| InChI Key | KIPSRYDSZQRPEA-UHFFFAOYSA-N |
| Molecular Formula | C2H4F3N |
Benzyltrimethylammonium hydroxide, 40% w/w aq. soln.
CAS: 100-85-6 Molecular Formula: C10H17NO Molecular Weight (g/mol): 167.252 MDL Number: MFCD00008281 InChI Key: NDKBVBUGCNGSJJ-UHFFFAOYSA-M Synonym: benzyltrimethylammonium hydroxide,triton b,n,n,n-trimethyl-1-phenylmethanaminium hydroxide,trimethylbenzylammonium hydroxide,benzyl trimethylammonium hydroxide,benzyl trimethyl ammonium hydroxide,trimethyl benzylammonium hydroxide,sumquat 2311,benzyltrimetylammonium hydroxide,n,n,n-trimethylbenzenemethanaminium hydroxide PubChem CID: 66854 IUPAC Name: benzyl(trimethyl)azanium;hydroxide SMILES: C[N+](C)(C)CC1=CC=CC=C1.[OH-]
| PubChem CID | 66854 |
|---|---|
| CAS | 100-85-6 |
| Molecular Weight (g/mol) | 167.252 |
| MDL Number | MFCD00008281 |
| SMILES | C[N+](C)(C)CC1=CC=CC=C1.[OH-] |
| Synonym | benzyltrimethylammonium hydroxide,triton b,n,n,n-trimethyl-1-phenylmethanaminium hydroxide,trimethylbenzylammonium hydroxide,benzyl trimethylammonium hydroxide,benzyl trimethyl ammonium hydroxide,trimethyl benzylammonium hydroxide,sumquat 2311,benzyltrimetylammonium hydroxide,n,n,n-trimethylbenzenemethanaminium hydroxide |
| IUPAC Name | benzyl(trimethyl)azanium;hydroxide |
| InChI Key | NDKBVBUGCNGSJJ-UHFFFAOYSA-M |
| Molecular Formula | C10H17NO |
Potassium oxalate hydrate, 99%
CAS: 6487-48-5 Molecular Formula: C2H2K2O5 Molecular Weight (g/mol): 184.23 MDL Number: MFCD00150033 InChI Key: QCPTVXCMROGZOL-UHFFFAOYSA-L Synonym: potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate PubChem CID: 2724193 IUPAC Name: dipotassium;oxalate;hydrate SMILES: O.[K+].[K+].[O-]C(=O)C([O-])=O
| PubChem CID | 2724193 |
|---|---|
| CAS | 6487-48-5 |
| Molecular Weight (g/mol) | 184.23 |
| MDL Number | MFCD00150033 |
| SMILES | O.[K+].[K+].[O-]C(=O)C([O-])=O |
| Synonym | potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate |
| IUPAC Name | dipotassium;oxalate;hydrate |
| InChI Key | QCPTVXCMROGZOL-UHFFFAOYSA-L |
| Molecular Formula | C2H2K2O5 |
Isopropyl acetate, 99+%
CAS: 108-21-4 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.133 MDL Number: MFCD00008877 InChI Key: JMMWKPVZQRWMSS-UHFFFAOYSA-N Synonym: isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester PubChem CID: 7915 IUPAC Name: propan-2-yl acetate SMILES: CC(C)OC(=O)C
| PubChem CID | 7915 |
|---|---|
| CAS | 108-21-4 |
| Molecular Weight (g/mol) | 102.133 |
| MDL Number | MFCD00008877 |
| SMILES | CC(C)OC(=O)C |
| Synonym | isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester |
| IUPAC Name | propan-2-yl acetate |
| InChI Key | JMMWKPVZQRWMSS-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
4-tert-Butylcalix[4]arene, 99%
CAS: 60705-62-6 Molecular Formula: C44H56O4 Molecular Weight (g/mol): 648.93 MDL Number: MFCD00066280 InChI Key: NVKLTRSBZLYZHK-UHFFFAOYSA-N Synonym: 4-tert-butylcalix 4 arene,tetra-tert-butyl tetrahydroxy calix 4 arene,5,11,17,23-tetra-t-butyl-25,26,27,28-tetrahydroxycalix-4-arene,4-t-butylcalix 4 arene,tetratert-butyl ? tetrol,p-tert-butylcalix 4 arene,4-tert-butylcalix 4 arene 5g,ethyl 2-5,11,17,23-tetra tert-butyl-26,27,28-tris 2-ethoxy-2-oxyethoxy pentacyclo 19.3.1.1∼3,7∼.1∼9,13∼.1∼15,19∼ octacosa-1 25 ,3 28 ,4,6,9 27 ,10,12,15,17, PubChem CID: 335377 IUPAC Name: 5,11,17,23-tetra-tert-butylpentacyclo[19.3.1.1³,⁷.1⁹,¹³.1¹⁵,¹⁹]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27,28-tetrol SMILES: CC(C)(C)C1=CC2=C(O)C(CC3=C(O)C(CC4=C(O)C(CC5=C(O)C(C2)=CC(=C5)C(C)(C)C)=CC(=C4)C(C)(C)C)=CC(=C3)C(C)(C)C)=C1
| PubChem CID | 335377 |
|---|---|
| CAS | 60705-62-6 |
| Molecular Weight (g/mol) | 648.93 |
| MDL Number | MFCD00066280 |
| SMILES | CC(C)(C)C1=CC2=C(O)C(CC3=C(O)C(CC4=C(O)C(CC5=C(O)C(C2)=CC(=C5)C(C)(C)C)=CC(=C4)C(C)(C)C)=CC(=C3)C(C)(C)C)=C1 |
| Synonym | 4-tert-butylcalix 4 arene,tetra-tert-butyl tetrahydroxy calix 4 arene,5,11,17,23-tetra-t-butyl-25,26,27,28-tetrahydroxycalix-4-arene,4-t-butylcalix 4 arene,tetratert-butyl ? tetrol,p-tert-butylcalix 4 arene,4-tert-butylcalix 4 arene 5g,ethyl 2-5,11,17,23-tetra tert-butyl-26,27,28-tris 2-ethoxy-2-oxyethoxy pentacyclo 19.3.1.1∼3,7∼.1∼9,13∼.1∼15,19∼ octacosa-1 25 ,3 28 ,4,6,9 27 ,10,12,15,17, |
| IUPAC Name | 5,11,17,23-tetra-tert-butylpentacyclo[19.3.1.1³,⁷.1⁹,¹³.1¹⁵,¹⁹]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27,28-tetrol |
| InChI Key | NVKLTRSBZLYZHK-UHFFFAOYSA-N |
| Molecular Formula | C44H56O4 |
Thermo Scientific Chemicals Xylenol orange, sodium salt, ACS reagent
CAS: 3618-43-7 Molecular Formula: C31H28N2Na4O13S Molecular Weight (g/mol): 760.59
| CAS | 3618-43-7 |
|---|---|
| Molecular Weight (g/mol) | 760.59 |
| Molecular Formula | C31H28N2Na4O13S |
2-Bromo-2-methylpropionyl Bromide, 98%
CAS: 20769-85-1 Molecular Formula: C4H6Br2O Molecular Weight (g/mol): 229.9 MDL Number: MFCD00000122 InChI Key: YOCIJWAHRAJQFT-UHFFFAOYSA-N Synonym: 2-bromo-2-methylpropionyl bromide,2-bromoisobutyryl bromide,propanoyl bromide, 2-bromo-2-methyl,bibb,2-bromo-2-methylpropionylbromide,unii-627f9n9dya,2-bromoisobutyrylbromide,2-bromo-2-methyl-propionyl bromide,alpha-bromoisobutyryl bromide,2-bromo-2-methyl-propanoyl bromide PubChem CID: 88685 IUPAC Name: 2-bromo-2-methylpropanoyl bromide SMILES: CC(C)(C(=O)Br)Br
| PubChem CID | 88685 |
|---|---|
| CAS | 20769-85-1 |
| Molecular Weight (g/mol) | 229.9 |
| MDL Number | MFCD00000122 |
| SMILES | CC(C)(C(=O)Br)Br |
| Synonym | 2-bromo-2-methylpropionyl bromide,2-bromoisobutyryl bromide,propanoyl bromide, 2-bromo-2-methyl,bibb,2-bromo-2-methylpropionylbromide,unii-627f9n9dya,2-bromoisobutyrylbromide,2-bromo-2-methyl-propionyl bromide,alpha-bromoisobutyryl bromide,2-bromo-2-methyl-propanoyl bromide |
| IUPAC Name | 2-bromo-2-methylpropanoyl bromide |
| InChI Key | YOCIJWAHRAJQFT-UHFFFAOYSA-N |
| Molecular Formula | C4H6Br2O |